C10H12ClN3 — CID 174283261
N,N-dimethylquinazolin-4-amine;hydrochloride (PubChem CID 174283261) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is N,N-dimethylquinazolin-4-amine;hydrochloride.
| Compound Name | N,N-dimethylquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 174283261 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | N,N-dimethylquinazolin-4-amine;hydrochloride |
| SMILES | CN(C)c1ncnc2ccccc12.Cl |
| InChI | InChI=1S/C10H11N3.ClH/c1-13(2)10-8-5-3-4-6-9(8)11-7-12-10;/h3-7H,1-2H3;1H |
| InChIKey | GZMPVLKFEJJLJA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |