C16H24ClN3 — CID 18590526
N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride (PubChem CID 18590526) has the molecular formula C16H24ClN3 and a molecular weight of 293.84 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride.
| Compound Name | N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 18590526 |
| Molecular Formula | C16H24ClN3 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride |
| SMILES | CC(C)CN(CC(C)C)c1ncnc2ccccc12.Cl |
| InChI | InChI=1S/C16H23N3.ClH/c1-12(2)9-19(10-13(3)4)16-14-7-5-6-8-15(14)17-11-18-16;/h5-8,11-13H,9-10H2,1-4H3;1H |
| InChIKey | ACSMELIYGDWYMK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |