C14H19N3O2 — CID 21104388
N,N-bis(2-methoxyethyl)quinazolin-4-amine (PubChem CID 21104388) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)quinazolin-4-amine.
| Compound Name | N,N-bis(2-methoxyethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 21104388 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N,N-bis(2-methoxyethyl)quinazolin-4-amine |
| SMILES | COCCN(CCOC)c1ncnc2ccccc12 |
| InChI | InChI=1S/C14H19N3O2/c1-18-9-7-17(8-10-19-2)14-12-5-3-4-6-13(12)15-11-16-14/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | SNAYBRKVYYDSGR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |