About 6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride
6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride (PubChem CID 18558695) has the molecular formula C17H26ClN3
and a molecular weight of 307.87 g/mol. Its IUPAC name is 6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride |
| PubChem CID | 18558695 |
| Molecular Formula | C17H26ClN3 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride |
| SMILES | Cc1ccc2ncnc(N(CC(C)C)CC(C)C)c2c1.Cl |
| InChI | InChI=1S/C17H25N3.ClH/c1-12(2)9-20(10-13(3)4)17-15-8-14(5)6-7-16(15)18-11-19-17;/h6-8,11-13H,9-10H2,1-5H3;1H |
| InChIKey | HCIQMRMHTMEDMQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride?
The IUPAC name of 6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride (CID 18558695) is 6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride.
What is the SMILES notation for 6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride?
The canonical SMILES for 6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride is Cc1ccc2ncnc(N(CC(C)C)CC(C)C)c2c1.Cl.
What is the InChIKey of 6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride?
The InChIKey is HCIQMRMHTMEDMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3.ClH/c1-12(2)9-20(10-13(3)4)17-15-8-14(5)6-7-16(15)18-11-19-17;/h6-8,11-13H,9-10H2,1-5H3;1H.
What are the key properties of 6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride?
6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride has a molecular weight of 307.87 g/mol, XLogP of 4.48, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-N,N-bis(2-methylpropyl)quinazolin-4-amine;hydrochloride is sourced from PubChem (CID 18558695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).