About diiodovanadium;4,6-dimethylquinazoline
diiodovanadium;4,6-dimethylquinazoline (PubChem CID 159465736) has the molecular formula C10H10I2N2V
and a molecular weight of 462.96 g/mol. Its IUPAC name is diiodovanadium;4,6-dimethylquinazoline.
Molecular Properties
| Compound Name | diiodovanadium;4,6-dimethylquinazoline |
| PubChem CID | 159465736 |
| Molecular Formula | C10H10I2N2V |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.84 |
| IUPAC Name | diiodovanadium;4,6-dimethylquinazoline |
| SMILES | Cc1ccc2ncnc(C)c2c1.I[V]I |
| InChI | InChI=1S/C10H10N2.2HI.V/c1-7-3-4-10-9(5-7)8(2)11-6-12-10;;;/h3-6H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | LVDQGOFQNGUVAR-UHFFFAOYSA-L |
| XLogP | 4.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diiodovanadium;4,6-dimethylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diiodovanadium;4,6-dimethylquinazoline?
The IUPAC name of diiodovanadium;4,6-dimethylquinazoline (CID 159465736) is diiodovanadium;4,6-dimethylquinazoline.
What is the SMILES notation for diiodovanadium;4,6-dimethylquinazoline?
The canonical SMILES for diiodovanadium;4,6-dimethylquinazoline is Cc1ccc2ncnc(C)c2c1.I[V]I.
What is the InChIKey of diiodovanadium;4,6-dimethylquinazoline?
The InChIKey is LVDQGOFQNGUVAR-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H10N2.2HI.V/c1-7-3-4-10-9(5-7)8(2)11-6-12-10;;;/h3-6H,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of diiodovanadium;4,6-dimethylquinazoline?
diiodovanadium;4,6-dimethylquinazoline has a molecular weight of 462.96 g/mol, XLogP of 4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diiodovanadium;4,6-dimethylquinazoline is sourced from PubChem (CID 159465736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).