About ethane;methanol;4-methylquinazoline
ethane;methanol;4-methylquinazoline (PubChem CID 91108480) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is ethane;methanol;4-methylquinazoline.
Molecular Properties
| Compound Name | ethane;methanol;4-methylquinazoline |
| PubChem CID | 91108480 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | ethane;methanol;4-methylquinazoline |
| SMILES | CC.CO.Cc1ncnc2ccccc12 |
| InChI | InChI=1S/C9H8N2.C2H6.CH4O/c1-7-8-4-2-3-5-9(8)11-6-10-7;2*1-2/h2-6H,1H3;1-2H3;2H,1H3 |
| InChIKey | NRNJHTZMZNUNBW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;methanol;4-methylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;4-methylquinazoline?
The IUPAC name of ethane;methanol;4-methylquinazoline (CID 91108480) is ethane;methanol;4-methylquinazoline.
What is the SMILES notation for ethane;methanol;4-methylquinazoline?
The canonical SMILES for ethane;methanol;4-methylquinazoline is CC.CO.Cc1ncnc2ccccc12.
What is the InChIKey of ethane;methanol;4-methylquinazoline?
The InChIKey is NRNJHTZMZNUNBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C2H6.CH4O/c1-7-8-4-2-3-5-9(8)11-6-10-7;2*1-2/h2-6H,1H3;1-2H3;2H,1H3.
What are the key properties of ethane;methanol;4-methylquinazoline?
ethane;methanol;4-methylquinazoline has a molecular weight of 206.29 g/mol, XLogP of 2.57, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;4-methylquinazoline is sourced from PubChem (CID 91108480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).