About fluoromethane;4-methylquinazoline
fluoromethane;4-methylquinazoline (PubChem CID 91079443) has the molecular formula C10H11FN2
and a molecular weight of 178.21 g/mol. Its IUPAC name is fluoromethane;4-methylquinazoline.
Molecular Properties
| Compound Name | fluoromethane;4-methylquinazoline |
| PubChem CID | 91079443 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | fluoromethane;4-methylquinazoline |
| SMILES | CF.Cc1ncnc2ccccc12 |
| InChI | InChI=1S/C9H8N2.CH3F/c1-7-8-4-2-3-5-9(8)11-6-10-7;1-2/h2-6H,1H3;1H3 |
| InChIKey | RYBDHEHHQUDQKL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze fluoromethane;4-methylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;4-methylquinazoline?
The IUPAC name of fluoromethane;4-methylquinazoline (CID 91079443) is fluoromethane;4-methylquinazoline.
What is the SMILES notation for fluoromethane;4-methylquinazoline?
The canonical SMILES for fluoromethane;4-methylquinazoline is CF.Cc1ncnc2ccccc12.
What is the InChIKey of fluoromethane;4-methylquinazoline?
The InChIKey is RYBDHEHHQUDQKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.CH3F/c1-7-8-4-2-3-5-9(8)11-6-10-7;1-2/h2-6H,1H3;1H3.
What are the key properties of fluoromethane;4-methylquinazoline?
fluoromethane;4-methylquinazoline has a molecular weight of 178.21 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;4-methylquinazoline is sourced from PubChem (CID 91079443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).