About quinazolin-4-yl hypofluorite
quinazolin-4-yl hypofluorite (PubChem CID 143671515) has the molecular formula C8H5FN2O
and a molecular weight of 164.14 g/mol. Its IUPAC name is quinazolin-4-yl hypofluorite.
Molecular Properties
| Compound Name | quinazolin-4-yl hypofluorite |
| PubChem CID | 143671515 |
| Molecular Formula | C8H5FN2O |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | quinazolin-4-yl hypofluorite |
| SMILES | FOc1ncnc2ccccc12 |
| InChI | InChI=1S/C8H5FN2O/c9-12-8-6-3-1-2-4-7(6)10-5-11-8/h1-5H |
| InChIKey | UUAIJZDLBBCMSQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze quinazolin-4-yl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinazolin-4-yl hypofluorite?
The IUPAC name of quinazolin-4-yl hypofluorite (CID 143671515) is quinazolin-4-yl hypofluorite.
What is the SMILES notation for quinazolin-4-yl hypofluorite?
The canonical SMILES for quinazolin-4-yl hypofluorite is FOc1ncnc2ccccc12.
What is the InChIKey of quinazolin-4-yl hypofluorite?
The InChIKey is UUAIJZDLBBCMSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5FN2O/c9-12-8-6-3-1-2-4-7(6)10-5-11-8/h1-5H.
What are the key properties of quinazolin-4-yl hypofluorite?
quinazolin-4-yl hypofluorite has a molecular weight of 164.14 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinazolin-4-yl hypofluorite is sourced from PubChem (CID 143671515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).