About 2-chloro-N-methylacetamide;4-methylquinazoline
2-chloro-N-methylacetamide;4-methylquinazoline (PubChem CID 91539258) has the molecular formula C12H14ClN3O
and a molecular weight of 251.72 g/mol. Its IUPAC name is 2-chloro-N-methylacetamide;4-methylquinazoline.
Molecular Properties
| Compound Name | 2-chloro-N-methylacetamide;4-methylquinazoline |
| PubChem CID | 91539258 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-chloro-N-methylacetamide;4-methylquinazoline |
| SMILES | CNC(=O)CCl.Cc1ncnc2ccccc12 |
| InChI | InChI=1S/C9H8N2.C3H6ClNO/c1-7-8-4-2-3-5-9(8)11-6-10-7;1-5-3(6)2-4/h2-6H,1H3;2H2,1H3,(H,5,6) |
| InChIKey | XRJFYBLUHCEBAC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-methylacetamide;4-methylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-methylacetamide;4-methylquinazoline?
The IUPAC name of 2-chloro-N-methylacetamide;4-methylquinazoline (CID 91539258) is 2-chloro-N-methylacetamide;4-methylquinazoline.
What is the SMILES notation for 2-chloro-N-methylacetamide;4-methylquinazoline?
The canonical SMILES for 2-chloro-N-methylacetamide;4-methylquinazoline is CNC(=O)CCl.Cc1ncnc2ccccc12.
What is the InChIKey of 2-chloro-N-methylacetamide;4-methylquinazoline?
The InChIKey is XRJFYBLUHCEBAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C3H6ClNO/c1-7-8-4-2-3-5-9(8)11-6-10-7;1-5-3(6)2-4/h2-6H,1H3;2H2,1H3,(H,5,6).
What are the key properties of 2-chloro-N-methylacetamide;4-methylquinazoline?
2-chloro-N-methylacetamide;4-methylquinazoline has a molecular weight of 251.72 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-methylacetamide;4-methylquinazoline is sourced from PubChem (CID 91539258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).