C15H20N4O — CID 115609152
N-tert-butyl-3-(quinazolin-4-ylamino)propanamide (PubChem CID 115609152) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is N-tert-butyl-3-(quinazolin-4-ylamino)propanamide.
| Compound Name | N-tert-butyl-3-(quinazolin-4-ylamino)propanamide |
|---|---|
| PubChem CID | 115609152 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | N-tert-butyl-3-(quinazolin-4-ylamino)propanamide |
| SMILES | CC(C)(C)NC(=O)CCNc1ncnc2ccccc12 |
| InChI | InChI=1S/C15H20N4O/c1-15(2,3)19-13(20)8-9-16-14-11-6-4-5-7-12(11)17-10-18-14/h4-7,10H,8-9H2,1-3H3,(H,19,20)(H,16,17,18) |
| InChIKey | NQHUKNWLVZSDPE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |