C15H18N4O3S — CID 110436099
N-(1,1-dioxothiolan-3-yl)-3-(quinazolin-4-ylamino)propanamide (PubChem CID 110436099) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(quinazolin-4-ylamino)propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(quinazolin-4-ylamino)propanamide |
|---|---|
| PubChem CID | 110436099 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(quinazolin-4-ylamino)propanamide |
| SMILES | O=C(CCNc1ncnc2ccccc12)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18N4O3S/c20-14(19-11-6-8-23(21,22)9-11)5-7-16-15-12-3-1-2-4-13(12)17-10-18-15/h1-4,10-11H,5-9H2,(H,19,20)(H,16,17,18) |
| InChIKey | QTWWSFCCTSGIPK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |