C17H26N2O3S — CID 109026349
3-(2-tert-butylanilino)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 109026349) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 3-(2-tert-butylanilino)-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-(2-tert-butylanilino)-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 109026349 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-(2-tert-butylanilino)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CC(C)(C)c1ccccc1NCCC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H26N2O3S/c1-17(2,3)14-6-4-5-7-15(14)18-10-8-16(20)19-13-9-11-23(21,22)12-13/h4-7,13,18H,8-12H2,1-3H3,(H,19,20) |
| InChIKey | LUIQYOTUCWQQBM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |