C9H12FN3O — CID 135192100
N-[5-fluoro-2-(propylamino)-3-pyridinyl]formamide (PubChem CID 135192100) has the molecular formula C9H12FN3O and a molecular weight of 197.21 g/mol. Its IUPAC name is N-[5-fluoro-2-(propylamino)-3-pyridinyl]formamide.
| Compound Name | N-[5-fluoro-2-(propylamino)-3-pyridinyl]formamide |
|---|---|
| PubChem CID | 135192100 |
| Molecular Formula | C9H12FN3O |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N-[5-fluoro-2-(propylamino)-3-pyridinyl]formamide |
| SMILES | CCCNc1ncc(F)cc1NC=O |
| InChI | InChI=1S/C9H12FN3O/c1-2-3-11-9-8(13-6-14)4-7(10)5-12-9/h4-6H,2-3H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | UTXNTCZANTUEAW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|