C8H8Br2F3N3 — CID 107490318
5-bromo-N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine (PubChem CID 107490318) has the molecular formula C8H8Br2F3N3 and a molecular weight of 362.98 g/mol. Its IUPAC name is 5-bromo-N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine.
| Compound Name | 5-bromo-N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 107490318 |
| Molecular Formula | C8H8Br2F3N3 |
| Molecular Weight | 362.98 g/mol |
| Exact Mass | 360.90 |
| IUPAC Name | 5-bromo-N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)CN(CCBr)c1ncc(Br)cn1 |
| InChI | InChI=1S/C8H8Br2F3N3/c9-1-2-16(5-8(11,12)13)7-14-3-6(10)4-15-7/h3-4H,1-2,5H2 |
| InChIKey | YVEAYTRZZZNFEO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.98 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|