C9H12BrF3N4 — CID 107490296
N-(2-bromoethyl)-5,6-dimethyl-N-(2,2,2-trifluoroethyl)-1,2,4-triazin-3-amine (PubChem CID 107490296) has the molecular formula C9H12BrF3N4 and a molecular weight of 313.12 g/mol. Its IUPAC name is N-(2-bromoethyl)-5,6-dimethyl-N-(2,2,2-trifluoroethyl)-1,2,4-triazin-3-amine.
| Compound Name | N-(2-bromoethyl)-5,6-dimethyl-N-(2,2,2-trifluoroethyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 107490296 |
| Molecular Formula | C9H12BrF3N4 |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | N-(2-bromoethyl)-5,6-dimethyl-N-(2,2,2-trifluoroethyl)-1,2,4-triazin-3-amine |
| SMILES | Cc1nnc(N(CCBr)CC(F)(F)F)nc1C |
| InChI | InChI=1S/C9H12BrF3N4/c1-6-7(2)15-16-8(14-6)17(4-3-10)5-9(11,12)13/h3-5H2,1-2H3 |
| InChIKey | HBRJBJOFGFBEDV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|