C9H13ClF2N4 — CID 107489951
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-5,6-dimethyl-1,2,4-triazin-3-amine (PubChem CID 107489951) has the molecular formula C9H13ClF2N4 and a molecular weight of 250.68 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-5,6-dimethyl-1,2,4-triazin-3-amine.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-5,6-dimethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 107489951 |
| Molecular Formula | C9H13ClF2N4 |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-5,6-dimethyl-1,2,4-triazin-3-amine |
| SMILES | Cc1nnc(N(CCCl)CC(F)F)nc1C |
| InChI | InChI=1S/C9H13ClF2N4/c1-6-7(2)14-15-9(13-6)16(4-3-10)5-8(11)12/h8H,3-5H2,1-2H3 |
| InChIKey | BNICHIZQMXVWIZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|