C10H17BrN4 — CID 114787886
N-(2-bromoethyl)-5,6-dimethyl-N-propyl-1,2,4-triazin-3-amine (PubChem CID 114787886) has the molecular formula C10H17BrN4 and a molecular weight of 273.18 g/mol. Its IUPAC name is N-(2-bromoethyl)-5,6-dimethyl-N-propyl-1,2,4-triazin-3-amine.
| Compound Name | N-(2-bromoethyl)-5,6-dimethyl-N-propyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 114787886 |
| Molecular Formula | C10H17BrN4 |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | N-(2-bromoethyl)-5,6-dimethyl-N-propyl-1,2,4-triazin-3-amine |
| SMILES | CCCN(CCBr)c1nnc(C)c(C)n1 |
| InChI | InChI=1S/C10H17BrN4/c1-4-6-15(7-5-11)10-12-8(2)9(3)13-14-10/h4-7H2,1-3H3 |
| InChIKey | QHWBHWLMMGUURF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|