C10H14BrF3N2S — CID 107488347
N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2,2,2-trifluoroethanamine (PubChem CID 107488347) has the molecular formula C10H14BrF3N2S and a molecular weight of 331.20 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 107488347 |
| Molecular Formula | C10H14BrF3N2S |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2,2,2-trifluoroethanamine |
| SMILES | Cc1nc(CN(CCBr)CC(F)(F)F)sc1C |
| InChI | InChI=1S/C10H14BrF3N2S/c1-7-8(2)17-9(15-7)5-16(4-3-11)6-10(12,13)14/h3-6H2,1-2H3 |
| InChIKey | QCBIKWXWUYANPB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|