About N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine
N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine (PubChem CID 80672449) has the molecular formula C13H21BrN2S
and a molecular weight of 317.30 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine.
Molecular Properties
| Compound Name | N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine |
| PubChem CID | 80672449 |
| Molecular Formula | C13H21BrN2S |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine |
| SMILES | Cc1nc(CN(CCBr)C2CCCC2)sc1C |
| InChI | InChI=1S/C13H21BrN2S/c1-10-11(2)17-13(15-10)9-16(8-7-14)12-5-3-4-6-12/h12H,3-9H2,1-2H3 |
| InChIKey | DCHRKPAPLITCFD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine?
The IUPAC name of N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine (CID 80672449) is N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine.
What is the SMILES notation for N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine?
The canonical SMILES for N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine is Cc1nc(CN(CCBr)C2CCCC2)sc1C.
What is the InChIKey of N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine?
The InChIKey is DCHRKPAPLITCFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21BrN2S/c1-10-11(2)17-13(15-10)9-16(8-7-14)12-5-3-4-6-12/h12H,3-9H2,1-2H3.
What are the key properties of N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine?
N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine has a molecular weight of 317.30 g/mol, XLogP of 3.90, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]cyclopentanamine is sourced from PubChem (CID 80672449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).