C13H23BrN2S — CID 80690180
N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]pentan-3-amine (PubChem CID 80690180) has the molecular formula C13H23BrN2S and a molecular weight of 319.31 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]pentan-3-amine.
| Compound Name | N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]pentan-3-amine |
|---|---|
| PubChem CID | 80690180 |
| Molecular Formula | C13H23BrN2S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]pentan-3-amine |
| SMILES | CCC(CC)N(CCBr)Cc1nc(C)c(C)s1 |
| InChI | InChI=1S/C13H23BrN2S/c1-5-12(6-2)16(8-7-14)9-13-15-10(3)11(4)17-13/h12H,5-9H2,1-4H3 |
| InChIKey | JOPCDCYOGQZQJL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|