C12H21ClN2S — CID 65169152
N-(2-chloroethyl)-4,5-dimethyl-N-pentan-3-yl-1,3-thiazol-2-amine (PubChem CID 65169152) has the molecular formula C12H21ClN2S and a molecular weight of 260.83 g/mol. Its IUPAC name is N-(2-chloroethyl)-4,5-dimethyl-N-pentan-3-yl-1,3-thiazol-2-amine.
| Compound Name | N-(2-chloroethyl)-4,5-dimethyl-N-pentan-3-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 65169152 |
| Molecular Formula | C12H21ClN2S |
| Molecular Weight | 260.83 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-(2-chloroethyl)-4,5-dimethyl-N-pentan-3-yl-1,3-thiazol-2-amine |
| SMILES | CCC(CC)N(CCCl)c1nc(C)c(C)s1 |
| InChI | InChI=1S/C12H21ClN2S/c1-5-11(6-2)15(8-7-13)12-14-9(3)10(4)16-12/h11H,5-8H2,1-4H3 |
| InChIKey | NOSIVTGCKIFSIZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.83 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|