C12H19ClN2S — CID 65168874
N-(2-chloroethyl)-N-cyclopentyl-4,5-dimethyl-1,3-thiazol-2-amine (PubChem CID 65168874) has the molecular formula C12H19ClN2S and a molecular weight of 258.82 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-cyclopentyl-4,5-dimethyl-1,3-thiazol-2-amine.
| Compound Name | N-(2-chloroethyl)-N-cyclopentyl-4,5-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 65168874 |
| Molecular Formula | C12H19ClN2S |
| Molecular Weight | 258.82 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-(2-chloroethyl)-N-cyclopentyl-4,5-dimethyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N(CCCl)C2CCCC2)sc1C |
| InChI | InChI=1S/C12H19ClN2S/c1-9-10(2)16-12(14-9)15(8-7-13)11-5-3-4-6-11/h11H,3-8H2,1-2H3 |
| InChIKey | PTHSGOZBGKOKEV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.82 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|