About N-(azetidin-3-yl)-N,4,5-trimethyl-1,3-thiazol-2-amine
N-(azetidin-3-yl)-N,4,5-trimethyl-1,3-thiazol-2-amine (PubChem CID 66184404) has the molecular formula C9H15N3S
and a molecular weight of 197.31 g/mol. Its IUPAC name is N-(azetidin-3-yl)-N,4,5-trimethyl-1,3-thiazol-2-amine.
Analyze N-(azetidin-3-yl)-N,4,5-trimethyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azetidin-3-yl)-N,4,5-trimethyl-1,3-thiazol-2-amine?
The IUPAC name of N-(azetidin-3-yl)-N,4,5-trimethyl-1,3-thiazol-2-amine (CID 66184404) is N-(azetidin-3-yl)-N,4,5-trimethyl-1,3-thiazol-2-amine.
What is the SMILES notation for N-(azetidin-3-yl)-N,4,5-trimethyl-1,3-thiazol-2-amine?
The canonical SMILES for N-(azetidin-3-yl)-N,4,5-trimethyl-1,3-thiazol-2-amine is Cc1nc(N(C)C2CNC2)sc1C.
What is the InChIKey of N-(azetidin-3-yl)-N,4,5-trimethyl-1,3-thiazol-2-amine?
The InChIKey is IEIFZGRMTHUCNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3S/c1-6-7(2)13-9(11-6)12(3)8-4-10-5-8/h8,10H,4-5H2,1-3H3.
What are the key properties of N-(azetidin-3-yl)-N,4,5-trimethyl-1,3-thiazol-2-amine?
N-(azetidin-3-yl)-N,4,5-trimethyl-1,3-thiazol-2-amine has a molecular weight of 197.31 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azetidin-3-yl)-N,4,5-trimethyl-1,3-thiazol-2-amine is sourced from PubChem (CID 66184404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).