C11H20ClN3S — CID 65277749
N-(2-chloroethyl)-3-ethyl-N-pentan-3-yl-1,2,4-thiadiazol-5-amine (PubChem CID 65277749) has the molecular formula C11H20ClN3S and a molecular weight of 261.82 g/mol. Its IUPAC name is N-(2-chloroethyl)-3-ethyl-N-pentan-3-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-chloroethyl)-3-ethyl-N-pentan-3-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65277749 |
| Molecular Formula | C11H20ClN3S |
| Molecular Weight | 261.82 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(2-chloroethyl)-3-ethyl-N-pentan-3-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CCc1nsc(N(CCCl)C(CC)CC)n1 |
| InChI | InChI=1S/C11H20ClN3S/c1-4-9(5-2)15(8-7-12)11-13-10(6-3)14-16-11/h9H,4-8H2,1-3H3 |
| InChIKey | PEHBKDBJBQHMBF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|