About 3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine
3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine (PubChem CID 18984635) has the molecular formula C5H8ClN3S
and a molecular weight of 177.66 g/mol. Its IUPAC name is 3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | 3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine |
| PubChem CID | 18984635 |
| Molecular Formula | C5H8ClN3S |
| Molecular Weight | 177.66 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine |
| SMILES | CN(C)c1nc(CCl)ns1 |
| InChI | InChI=1S/C5H8ClN3S/c1-9(2)5-7-4(3-6)8-10-5/h3H2,1-2H3 |
| InChIKey | UUINIJPFNXSOQK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.66 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine (CID 18984635) is 3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine is CN(C)c1nc(CCl)ns1.
What is the InChIKey of 3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine?
The InChIKey is UUINIJPFNXSOQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClN3S/c1-9(2)5-7-4(3-6)8-10-5/h3H2,1-2H3.
What are the key properties of 3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine?
3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine has a molecular weight of 177.66 g/mol, XLogP of 1.34, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-N,N-dimethyl-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 18984635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).