C10H20N4S — CID 107207074
N'-(3-ethyl-1,2,4-thiadiazol-5-yl)-N'-methylpentane-1,5-diamine (PubChem CID 107207074) has the molecular formula C10H20N4S and a molecular weight of 228.36 g/mol. Its IUPAC name is N'-(3-ethyl-1,2,4-thiadiazol-5-yl)-N'-methylpentane-1,5-diamine.
| Compound Name | N'-(3-ethyl-1,2,4-thiadiazol-5-yl)-N'-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 107207074 |
| Molecular Formula | C10H20N4S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | N'-(3-ethyl-1,2,4-thiadiazol-5-yl)-N'-methylpentane-1,5-diamine |
| SMILES | CCc1nsc(N(C)CCCCCN)n1 |
| InChI | InChI=1S/C10H20N4S/c1-3-9-12-10(15-13-9)14(2)8-6-4-5-7-11/h3-8,11H2,1-2H3 |
| InChIKey | GXFYPJZVBFNSRX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|