C10H16BrN3S — CID 80680145
N-[(3-bromocyclobutyl)methyl]-3-ethyl-N-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 80680145) has the molecular formula C10H16BrN3S and a molecular weight of 290.23 g/mol. Its IUPAC name is N-[(3-bromocyclobutyl)methyl]-3-ethyl-N-methyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[(3-bromocyclobutyl)methyl]-3-ethyl-N-methyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 80680145 |
| Molecular Formula | C10H16BrN3S |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | N-[(3-bromocyclobutyl)methyl]-3-ethyl-N-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCc1nsc(N(C)CC2CC(Br)C2)n1 |
| InChI | InChI=1S/C10H16BrN3S/c1-3-9-12-10(15-13-9)14(2)6-7-4-8(11)5-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | FATAAKUWVJSMLP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|