C13H19N5S — CID 129331437
3-ethyl-N-methyl-N-[[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,2,4-thiadiazol-5-amine (PubChem CID 129331437) has the molecular formula C13H19N5S and a molecular weight of 277.40 g/mol. Its IUPAC name is 3-ethyl-N-methyl-N-[[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-ethyl-N-methyl-N-[[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 129331437 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 3-ethyl-N-methyl-N-[[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,2,4-thiadiazol-5-amine |
| SMILES | CCc1nsc(N(C)C[C@@H]2CCc3nccn3C2)n1 |
| InChI | InChI=1S/C13H19N5S/c1-3-11-15-13(19-16-11)17(2)8-10-4-5-12-14-6-7-18(12)9-10/h6-7,10H,3-5,8-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | JLNUVMWSPCMFQI-JTQLQIEISA-N |
| XLogP | 2.00 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |