C9H17N3S — CID 107207013
N'-methyl-N'-(1,3-thiazol-2-yl)pentane-1,5-diamine (PubChem CID 107207013) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is N'-methyl-N'-(1,3-thiazol-2-yl)pentane-1,5-diamine.
| Compound Name | N'-methyl-N'-(1,3-thiazol-2-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 107207013 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | N'-methyl-N'-(1,3-thiazol-2-yl)pentane-1,5-diamine |
| SMILES | CN(CCCCCN)c1nccs1 |
| InChI | InChI=1S/C9H17N3S/c1-12(7-4-2-3-5-10)9-11-6-8-13-9/h6,8H,2-5,7,10H2,1H3 |
| InChIKey | OGOQHALYLPELSI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|