C9H16N2S — CID 115201070
N'-methyl-N'-thiophen-2-ylbutane-1,4-diamine (PubChem CID 115201070) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is N'-methyl-N'-thiophen-2-ylbutane-1,4-diamine.
| Compound Name | N'-methyl-N'-thiophen-2-ylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115201070 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N'-methyl-N'-thiophen-2-ylbutane-1,4-diamine |
| SMILES | CN(CCCCN)c1cccs1 |
| InChI | InChI=1S/C9H16N2S/c1-11(7-3-2-6-10)9-5-4-8-12-9/h4-5,8H,2-3,6-7,10H2,1H3 |
| InChIKey | XGCCGDJRVYFKRK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|