C13H22N2 — CID 94255608
N'-(2,6-dimethylphenyl)-N'-methylbutane-1,4-diamine (PubChem CID 94255608) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N'-(2,6-dimethylphenyl)-N'-methylbutane-1,4-diamine.
| Compound Name | N'-(2,6-dimethylphenyl)-N'-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 94255608 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N'-(2,6-dimethylphenyl)-N'-methylbutane-1,4-diamine |
| SMILES | Cc1cccc(C)c1N(C)CCCCN |
| InChI | InChI=1S/C13H22N2/c1-11-7-6-8-12(2)13(11)15(3)10-5-4-9-14/h6-8H,4-5,9-10,14H2,1-3H3 |
| InChIKey | XMVNQXYGJNREQH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|