C14H21N3 — CID 115201113
N'-methyl-N'-(2-methyl-1H-indol-3-yl)butane-1,4-diamine (PubChem CID 115201113) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is N'-methyl-N'-(2-methyl-1H-indol-3-yl)butane-1,4-diamine.
| Compound Name | N'-methyl-N'-(2-methyl-1H-indol-3-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 115201113 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | N'-methyl-N'-(2-methyl-1H-indol-3-yl)butane-1,4-diamine |
| SMILES | Cc1[nH]c2ccccc2c1N(C)CCCCN |
| InChI | InChI=1S/C14H21N3/c1-11-14(17(2)10-6-5-9-15)12-7-3-4-8-13(12)16-11/h3-4,7-8,16H,5-6,9-10,15H2,1-2H3 |
| InChIKey | KWTXXJUVJCNWDT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|