C15H23N3 — CID 115203083
N',2-dimethyl-N'-(2-methyl-1H-indol-3-yl)butane-1,4-diamine (PubChem CID 115203083) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is N',2-dimethyl-N'-(2-methyl-1H-indol-3-yl)butane-1,4-diamine.
| Compound Name | N',2-dimethyl-N'-(2-methyl-1H-indol-3-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 115203083 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | N',2-dimethyl-N'-(2-methyl-1H-indol-3-yl)butane-1,4-diamine |
| SMILES | Cc1[nH]c2ccccc2c1N(C)CCC(C)CN |
| InChI | InChI=1S/C15H23N3/c1-11(10-16)8-9-18(3)15-12(2)17-14-7-5-4-6-13(14)15/h4-7,11,17H,8-10,16H2,1-3H3 |
| InChIKey | XYYSMHJEUWOVHL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |