C17H19N3 — CID 117041626
N-[4-(aminomethyl)phenyl]-N,2-dimethyl-1H-indol-3-amine (PubChem CID 117041626) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-N,2-dimethyl-1H-indol-3-amine.
| Compound Name | N-[4-(aminomethyl)phenyl]-N,2-dimethyl-1H-indol-3-amine |
|---|---|
| PubChem CID | 117041626 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-N,2-dimethyl-1H-indol-3-amine |
| SMILES | Cc1[nH]c2ccccc2c1N(C)c1ccc(CN)cc1 |
| InChI | InChI=1S/C17H19N3/c1-12-17(15-5-3-4-6-16(15)19-12)20(2)14-9-7-13(11-18)8-10-14/h3-10,19H,11,18H2,1-2H3 |
| InChIKey | FQOJBVQDKUULBF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |