C16H16BrN3 — CID 115125393
4-bromo-1-N-methyl-1-N-(2-methyl-1H-indol-3-yl)benzene-1,2-diamine (PubChem CID 115125393) has the molecular formula C16H16BrN3 and a molecular weight of 330.23 g/mol. Its IUPAC name is 4-bromo-1-N-methyl-1-N-(2-methyl-1H-indol-3-yl)benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-methyl-1-N-(2-methyl-1H-indol-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115125393 |
| Molecular Formula | C16H16BrN3 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4-bromo-1-N-methyl-1-N-(2-methyl-1H-indol-3-yl)benzene-1,2-diamine |
| SMILES | Cc1[nH]c2ccccc2c1N(C)c1ccc(Br)cc1N |
| InChI | InChI=1S/C16H16BrN3/c1-10-16(12-5-3-4-6-14(12)19-10)20(2)15-8-7-11(17)9-13(15)18/h3-9,19H,18H2,1-2H3 |
| InChIKey | ADYHQHVNOQECRS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|