C16H19BrN2O — CID 115125378
4-bromo-1-N-(4-methoxy-2,5-dimethylphenyl)-1-N-methylbenzene-1,2-diamine (PubChem CID 115125378) has the molecular formula C16H19BrN2O and a molecular weight of 335.25 g/mol. Its IUPAC name is 4-bromo-1-N-(4-methoxy-2,5-dimethylphenyl)-1-N-methylbenzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-(4-methoxy-2,5-dimethylphenyl)-1-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115125378 |
| Molecular Formula | C16H19BrN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-bromo-1-N-(4-methoxy-2,5-dimethylphenyl)-1-N-methylbenzene-1,2-diamine |
| SMILES | COc1cc(C)c(N(C)c2ccc(Br)cc2N)cc1C |
| InChI | InChI=1S/C16H19BrN2O/c1-10-8-16(20-4)11(2)7-15(10)19(3)14-6-5-12(17)9-13(14)18/h5-9H,18H2,1-4H3 |
| InChIKey | AFNYISBSRUFLKD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|