C10H16N2O2 — CID 130552429
2-N,4-dimethoxy-2-N,5-dimethylbenzene-1,2-diamine (PubChem CID 130552429) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-N,4-dimethoxy-2-N,5-dimethylbenzene-1,2-diamine.
| Compound Name | 2-N,4-dimethoxy-2-N,5-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 130552429 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2-N,4-dimethoxy-2-N,5-dimethylbenzene-1,2-diamine |
| SMILES | COc1cc(N(C)OC)c(N)cc1C |
| InChI | InChI=1S/C10H16N2O2/c1-7-5-8(11)9(12(2)14-4)6-10(7)13-3/h5-6H,11H2,1-4H3 |
| InChIKey | WXVYQFJMUWLQQC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|