C7H12N2S — CID 96634753
N'-methyl-N'-thiophen-2-ylethane-1,2-diamine (PubChem CID 96634753) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is N'-methyl-N'-thiophen-2-ylethane-1,2-diamine.
| Compound Name | N'-methyl-N'-thiophen-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 96634753 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | N'-methyl-N'-thiophen-2-ylethane-1,2-diamine |
| SMILES | CN(CCN)c1cccs1 |
| InChI | InChI=1S/C7H12N2S/c1-9(5-4-8)7-3-2-6-10-7/h2-3,6H,4-5,8H2,1H3 |
| InChIKey | RHQLWMPJZLUPCI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |