C8H10BrF3N2S — CID 107490316
N-(2-bromoethyl)-4-methyl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine (PubChem CID 107490316) has the molecular formula C8H10BrF3N2S and a molecular weight of 303.15 g/mol. Its IUPAC name is N-(2-bromoethyl)-4-methyl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-bromoethyl)-4-methyl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107490316 |
| Molecular Formula | C8H10BrF3N2S |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | N-(2-bromoethyl)-4-methyl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine |
| SMILES | Cc1csc(N(CCBr)CC(F)(F)F)n1 |
| InChI | InChI=1S/C8H10BrF3N2S/c1-6-4-15-7(13-6)14(3-2-9)5-8(10,11)12/h4H,2-3,5H2,1H3 |
| InChIKey | CVPQHBQIZKOTEW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|