C13H15BrN2S — CID 80674189
N-benzyl-N-(2-bromoethyl)-4-methyl-1,3-thiazol-2-amine (PubChem CID 80674189) has the molecular formula C13H15BrN2S and a molecular weight of 311.25 g/mol. Its IUPAC name is N-benzyl-N-(2-bromoethyl)-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-benzyl-N-(2-bromoethyl)-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 80674189 |
| Molecular Formula | C13H15BrN2S |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | N-benzyl-N-(2-bromoethyl)-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(N(CCBr)Cc2ccccc2)n1 |
| InChI | InChI=1S/C13H15BrN2S/c1-11-10-17-13(15-11)16(8-7-14)9-12-5-3-2-4-6-12/h2-6,10H,7-9H2,1H3 |
| InChIKey | UCDCSPQXHYAXKL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|