C19H20N2OS — CID 130160087
1-[2-(dibenzylamino)-1,3-thiazol-4-yl]ethanol (PubChem CID 130160087) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-[2-(dibenzylamino)-1,3-thiazol-4-yl]ethanol.
| Compound Name | 1-[2-(dibenzylamino)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 130160087 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-[2-(dibenzylamino)-1,3-thiazol-4-yl]ethanol |
| SMILES | CC(O)c1csc(N(Cc2ccccc2)Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H20N2OS/c1-15(22)18-14-23-19(20-18)21(12-16-8-4-2-5-9-16)13-17-10-6-3-7-11-17/h2-11,14-15,22H,12-13H2,1H3 |
| InChIKey | DBCPGPIZVKRZFQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |