C14H16N2OS — CID 64542419
1-[2-[benzyl(ethyl)amino]-1,3-thiazol-4-yl]ethanone (PubChem CID 64542419) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-[2-[benzyl(ethyl)amino]-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-[benzyl(ethyl)amino]-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 64542419 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-[2-[benzyl(ethyl)amino]-1,3-thiazol-4-yl]ethanone |
| SMILES | CCN(Cc1ccccc1)c1nc(C(C)=O)cs1 |
| InChI | InChI=1S/C14H16N2OS/c1-3-16(9-12-7-5-4-6-8-12)14-15-13(10-18-14)11(2)17/h4-8,10H,3,9H2,1-2H3 |
| InChIKey | JMDWVTVYFFMICK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |