C15H21N3S — CID 107368586
N'-benzyl-N'-(4-ethyl-1,3-thiazol-2-yl)propane-1,3-diamine (PubChem CID 107368586) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is N'-benzyl-N'-(4-ethyl-1,3-thiazol-2-yl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-(4-ethyl-1,3-thiazol-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 107368586 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N'-benzyl-N'-(4-ethyl-1,3-thiazol-2-yl)propane-1,3-diamine |
| SMILES | CCc1csc(N(CCCN)Cc2ccccc2)n1 |
| InChI | InChI=1S/C15H21N3S/c1-2-14-12-19-15(17-14)18(10-6-9-16)11-13-7-4-3-5-8-13/h3-5,7-8,12H,2,6,9-11,16H2,1H3 |
| InChIKey | BTWKQXKGJXACFU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |