C9H13BrF2N2S — CID 107489443
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-ethyl-1,3-thiazol-2-amine (PubChem CID 107489443) has the molecular formula C9H13BrF2N2S and a molecular weight of 299.18 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-ethyl-1,3-thiazol-2-amine.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-ethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107489443 |
| Molecular Formula | C9H13BrF2N2S |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-4-ethyl-1,3-thiazol-2-amine |
| SMILES | CCc1csc(N(CCBr)CC(F)F)n1 |
| InChI | InChI=1S/C9H13BrF2N2S/c1-2-7-6-15-9(13-7)14(4-3-10)5-8(11)12/h6,8H,2-5H2,1H3 |
| InChIKey | FPMMCNXSGXYRHD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|