C9H9BrF4N2O2S — CID 107492981
N-(2-bromoethyl)-5-fluoro-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide (PubChem CID 107492981) has the molecular formula C9H9BrF4N2O2S and a molecular weight of 365.15 g/mol. Its IUPAC name is N-(2-bromoethyl)-5-fluoro-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide.
| Compound Name | N-(2-bromoethyl)-5-fluoro-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107492981 |
| Molecular Formula | C9H9BrF4N2O2S |
| Molecular Weight | 365.15 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | N-(2-bromoethyl)-5-fluoro-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(c1cncc(F)c1)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C9H9BrF4N2O2S/c10-1-2-16(6-9(12,13)14)19(17,18)8-3-7(11)4-15-5-8/h3-5H,1-2,6H2 |
| InChIKey | JWOZDBSGGGZRPK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.15 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|