C9H14N4 — CID 91092950
2-N-ethyl-2-N-methyl-3-(methylideneamino)pyridine-2,4-diamine (PubChem CID 91092950) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-N-ethyl-2-N-methyl-3-(methylideneamino)pyridine-2,4-diamine.
| Compound Name | 2-N-ethyl-2-N-methyl-3-(methylideneamino)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 91092950 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-N-ethyl-2-N-methyl-3-(methylideneamino)pyridine-2,4-diamine |
| SMILES | C=Nc1c(N)ccnc1N(C)CC |
| InChI | InChI=1S/C9H14N4/c1-4-13(3)9-8(11-2)7(10)5-6-12-9/h5-6H,2,4H2,1,3H3,(H2,10,12) |
| InChIKey | WIXCNIPYSBXSOQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|