C8H13N3 — CID 43263136
2-N-ethyl-2-N-methylpyridine-2,5-diamine (PubChem CID 43263136) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-N-ethyl-2-N-methylpyridine-2,5-diamine.
| Compound Name | 2-N-ethyl-2-N-methylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 43263136 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 2-N-ethyl-2-N-methylpyridine-2,5-diamine |
| SMILES | CCN(C)c1ccc(N)cn1 |
| InChI | InChI=1S/C8H13N3/c1-3-11(2)8-5-4-7(9)6-10-8/h4-6H,3,9H2,1-2H3 |
| InChIKey | PCOIODSNSWYQHK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |