C9H15N5O — CID 175430745
2-[(5-amino-2-pyridinyl)-methylamino]ethylurea (PubChem CID 175430745) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-[(5-amino-2-pyridinyl)-methylamino]ethylurea.
| Compound Name | 2-[(5-amino-2-pyridinyl)-methylamino]ethylurea |
|---|---|
| PubChem CID | 175430745 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2-[(5-amino-2-pyridinyl)-methylamino]ethylurea |
| SMILES | CN(CCNC(N)=O)c1ccc(N)cn1 |
| InChI | InChI=1S/C9H15N5O/c1-14(5-4-12-9(11)15)8-3-2-7(10)6-13-8/h2-3,6H,4-5,10H2,1H3,(H3,11,12,15) |
| InChIKey | ICLTVCIMEWDKLQ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |