C9H14N4O2 — CID 154385194
2-[(6-amino-3-pyridinyl)-methylamino]ethylcarbamic acid (PubChem CID 154385194) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-[(6-amino-3-pyridinyl)-methylamino]ethylcarbamic acid.
| Compound Name | 2-[(6-amino-3-pyridinyl)-methylamino]ethylcarbamic acid |
|---|---|
| PubChem CID | 154385194 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-[(6-amino-3-pyridinyl)-methylamino]ethylcarbamic acid |
| SMILES | CN(CCNC(=O)O)c1ccc(N)nc1 |
| InChI | InChI=1S/C9H14N4O2/c1-13(5-4-11-9(14)15)7-2-3-8(10)12-6-7/h2-3,6,11H,4-5H2,1H3,(H2,10,12)(H,14,15) |
| InChIKey | FDFDKABIXSNHCE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |