C9H13N3 — CID 83635531
5-N-methyl-5-N-prop-2-enylpyridine-2,5-diamine (PubChem CID 83635531) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-N-methyl-5-N-prop-2-enylpyridine-2,5-diamine.
| Compound Name | 5-N-methyl-5-N-prop-2-enylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 83635531 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 5-N-methyl-5-N-prop-2-enylpyridine-2,5-diamine |
| SMILES | C=CCN(C)c1ccc(N)nc1 |
| InChI | InChI=1S/C9H13N3/c1-3-6-12(2)8-4-5-9(10)11-7-8/h3-5,7H,1,6H2,2H3,(H2,10,11) |
| InChIKey | BLJASDMIGWWIRE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|